C17H13F2NO3 — CID 102346465
3-(1,1-difluoro-2-oxo-2-phenylethyl)-3-hydroxy-1-methylindol-2-one (PubChem CID 102346465) has the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. Its IUPAC name is 3-(1,1-difluoro-2-oxo-2-phenylethyl)-3-hydroxy-1-methylindol-2-one.
| Compound Name | 3-(1,1-difluoro-2-oxo-2-phenylethyl)-3-hydroxy-1-methylindol-2-one |
|---|---|
| PubChem CID | 102346465 |
| Molecular Formula | C17H13F2NO3 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-(1,1-difluoro-2-oxo-2-phenylethyl)-3-hydroxy-1-methylindol-2-one |
| SMILES | CN1C(=O)C(O)(C(F)(F)C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H13F2NO3/c1-20-13-10-6-5-9-12(13)16(23,15(20)22)17(18,19)14(21)11-7-3-2-4-8-11/h2-10,23H,1H3 |
| InChIKey | VSCPIDHBHYFTOI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |