C18H12F2O3 — CID 135028525
4-(1,1-difluoro-2-oxo-2-phenylethyl)-4-hydroxynaphthalen-1-one (PubChem CID 135028525) has the molecular formula C18H12F2O3 and a molecular weight of 314.29 g/mol. Its IUPAC name is 4-(1,1-difluoro-2-oxo-2-phenylethyl)-4-hydroxynaphthalen-1-one.
| Compound Name | 4-(1,1-difluoro-2-oxo-2-phenylethyl)-4-hydroxynaphthalen-1-one |
|---|---|
| PubChem CID | 135028525 |
| Molecular Formula | C18H12F2O3 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-(1,1-difluoro-2-oxo-2-phenylethyl)-4-hydroxynaphthalen-1-one |
| SMILES | O=C1C=CC(O)(C(F)(F)C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H12F2O3/c19-18(20,16(22)12-6-2-1-3-7-12)17(23)11-10-15(21)13-8-4-5-9-14(13)17/h1-11,23H |
| InChIKey | CXMWKMXABFNNGY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |