C18H19N3O2 — CID 11197628
N'-(3-ethyl-1-methyl-2-oxoindol-3-yl)benzohydrazide (PubChem CID 11197628) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N'-(3-ethyl-1-methyl-2-oxoindol-3-yl)benzohydrazide.
| Compound Name | N'-(3-ethyl-1-methyl-2-oxoindol-3-yl)benzohydrazide |
|---|---|
| PubChem CID | 11197628 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N'-(3-ethyl-1-methyl-2-oxoindol-3-yl)benzohydrazide |
| SMILES | CCC1(NNC(=O)c2ccccc2)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C18H19N3O2/c1-3-18(20-19-16(22)13-9-5-4-6-10-13)14-11-7-8-12-15(14)21(2)17(18)23/h4-12,20H,3H2,1-2H3,(H,19,22) |
| InChIKey | LOVQRYUTRVAVIP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|