C14H15NO3 — CID 57389469
methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate (PubChem CID 57389469) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 57389469 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C/C1(C)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C14H15NO3/c1-14(9-8-12(16)18-3)10-6-4-5-7-11(10)15(2)13(14)17/h4-9H,1-3H3/b9-8+ |
| InChIKey | XKRIWEVHGIKHGY-CMDGGOBGSA-N |
| XLogP | 1.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|