methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate

C14H15NO3 — CID 57389469

IUPACmethyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate
SMILESCOC(=O)/C=C/C1(C)C(=O)N(C)c2ccccc21
InChIInChI=1S/C14H15NO3/c1-14(9-8-12(16)18-3)10-6-4-5-7-11(10)15(2)13(14)17/h4-9H,1-3H3/b9-8+
InChIKeyXKRIWEVHGIKHGY-CMDGGOBGSA-N
MW245.28 g/mol
LogP1.65
Rot. Bonds2

About methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate

methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate (PubChem CID 57389469) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate.

Molecular Properties

Compound Namemethyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate
PubChem CID57389469
Molecular FormulaC14H15NO3
Molecular Weight245.28 g/mol
Exact Mass245.11
IUPAC Namemethyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate
SMILESCOC(=O)/C=C/C1(C)C(=O)N(C)c2ccccc21
InChIInChI=1S/C14H15NO3/c1-14(9-8-12(16)18-3)10-6-4-5-7-11(10)15(2)13(14)17/h4-9H,1-3H3/b9-8+
InChIKeyXKRIWEVHGIKHGY-CMDGGOBGSA-N
XLogP1.65
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 51.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate?
The IUPAC name of methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate (CID 57389469) is methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate.
What is the SMILES notation for methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate?
The canonical SMILES for methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate is COC(=O)/C=C/C1(C)C(=O)N(C)c2ccccc21.
What is the InChIKey of methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate?
The InChIKey is XKRIWEVHGIKHGY-CMDGGOBGSA-N. The full InChI is InChI=1S/C14H15NO3/c1-14(9-8-12(16)18-3)10-6-4-5-7-11(10)15(2)13(14)17/h4-9H,1-3H3/b9-8+.
What are the key properties of methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate?
methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate has a molecular weight of 245.28 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(1,3-dimethyl-2-oxoindol-3-yl)prop-2-enoate is sourced from PubChem (CID 57389469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).