C13H14BrNO4 — CID 102189808
methyl (2R)-3-bromo-2-[(3R)-3-hydroxy-1-methyl-2-oxoindol-3-yl]propanoate (PubChem CID 102189808) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is methyl (2R)-3-bromo-2-[(3R)-3-hydroxy-1-methyl-2-oxoindol-3-yl]propanoate.
| Compound Name | methyl (2R)-3-bromo-2-[(3R)-3-hydroxy-1-methyl-2-oxoindol-3-yl]propanoate |
|---|---|
| PubChem CID | 102189808 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | methyl (2R)-3-bromo-2-[(3R)-3-hydroxy-1-methyl-2-oxoindol-3-yl]propanoate |
| SMILES | COC(=O)[C@H](CBr)[C@]1(O)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C13H14BrNO4/c1-15-10-6-4-3-5-8(10)13(18,12(15)17)9(7-14)11(16)19-2/h3-6,9,18H,7H2,1-2H3/t9-,13-/m0/s1 |
| InChIKey | GPNLSDCTLZMETK-ZANVPECISA-N |
| XLogP | 1.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|