C24H26ClNO3 — CID 132599834
tert-butyl 2-[(R)-[(3R)-5-chloro-1,3-dimethyl-2-oxoindol-3-yl]-phenylmethyl]prop-2-enoate (PubChem CID 132599834) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is tert-butyl 2-[(R)-[(3R)-5-chloro-1,3-dimethyl-2-oxoindol-3-yl]-phenylmethyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[(R)-[(3R)-5-chloro-1,3-dimethyl-2-oxoindol-3-yl]-phenylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 132599834 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | tert-butyl 2-[(R)-[(3R)-5-chloro-1,3-dimethyl-2-oxoindol-3-yl]-phenylmethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)[C@H](c1ccccc1)[C@@]1(C)C(=O)N(C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H26ClNO3/c1-15(21(27)29-23(2,3)4)20(16-10-8-7-9-11-16)24(5)18-14-17(25)12-13-19(18)26(6)22(24)28/h7-14,20H,1H2,2-6H3/t20-,24+/m1/s1 |
| InChIKey | JMIHWVYJJDQVNE-YKSBVNFPSA-N |
| XLogP | 5.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|