C23H22ClN3O5 — CID 58017107
tert-butyl 2-(1-benzyl-5'-chloro-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetate (PubChem CID 58017107) has the molecular formula C23H22ClN3O5 and a molecular weight of 455.90 g/mol. Its IUPAC name is tert-butyl 2-(1-benzyl-5'-chloro-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetate.
| Compound Name | tert-butyl 2-(1-benzyl-5'-chloro-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetate |
|---|---|
| PubChem CID | 58017107 |
| Molecular Formula | C23H22ClN3O5 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | tert-butyl 2-(1-benzyl-5'-chloro-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)C2(NC(=O)N(Cc3ccccc3)C2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H22ClN3O5/c1-22(2,3)32-18(28)13-26-17-10-9-15(24)11-16(17)23(19(26)29)20(30)27(21(31)25-23)12-14-7-5-4-6-8-14/h4-11H,12-13H2,1-3H3,(H,25,31) |
| InChIKey | LJLCEWFCCFAYOF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|