C25H25ClN2O7S — CID 24828993
tert-butyl 2-[5-chloro-1'-[(4-methylsulfonylphenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetate (PubChem CID 24828993) has the molecular formula C25H25ClN2O7S and a molecular weight of 533.00 g/mol. Its IUPAC name is tert-butyl 2-[5-chloro-1'-[(4-methylsulfonylphenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetate.
| Compound Name | tert-butyl 2-[5-chloro-1'-[(4-methylsulfonylphenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetate |
|---|---|
| PubChem CID | 24828993 |
| Molecular Formula | C25H25ClN2O7S |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | tert-butyl 2-[5-chloro-1'-[(4-methylsulfonylphenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)C2(CC(=O)N(Cc3ccc(S(C)(=O)=O)cc3)C2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H25ClN2O7S/c1-24(2,3)35-21(30)14-27-19-10-7-16(26)11-18(19)25(22(27)31)12-20(29)28(23(25)32)13-15-5-8-17(9-6-15)36(4,33)34/h5-11H,12-14H2,1-4H3 |
| InChIKey | YGTWBMKVKUITQZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.00 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|