C23H16ClN3O5 — CID 15950022
2-[5-chloro-2,2',5'-trioxo-1'-(quinolin-2-ylmethyl)spiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid (PubChem CID 15950022) has the molecular formula C23H16ClN3O5 and a molecular weight of 449.85 g/mol. Its IUPAC name is 2-[5-chloro-2,2',5'-trioxo-1'-(quinolin-2-ylmethyl)spiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-2,2',5'-trioxo-1'-(quinolin-2-ylmethyl)spiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
|---|---|
| PubChem CID | 15950022 |
| Molecular Formula | C23H16ClN3O5 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2-[5-chloro-2,2',5'-trioxo-1'-(quinolin-2-ylmethyl)spiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C2(CC(=O)N(Cc3ccc4ccccc4n3)C2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H16ClN3O5/c24-14-6-8-18-16(9-14)23(21(31)26(18)12-20(29)30)10-19(28)27(22(23)32)11-15-7-5-13-3-1-2-4-17(13)25-15/h1-9H,10-12H2,(H,29,30) |
| InChIKey | ZBLQINMHWPBDTQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|