C20H13Cl3N2O5 — CID 15949481
2-[5-chloro-1'-[(2,5-dichlorophenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid (PubChem CID 15949481) has the molecular formula C20H13Cl3N2O5 and a molecular weight of 467.69 g/mol. Its IUPAC name is 2-[5-chloro-1'-[(2,5-dichlorophenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-1'-[(2,5-dichlorophenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
|---|---|
| PubChem CID | 15949481 |
| Molecular Formula | C20H13Cl3N2O5 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | 2-[5-chloro-1'-[(2,5-dichlorophenyl)methyl]-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C2(CC(=O)N(Cc3cc(Cl)ccc3Cl)C2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H13Cl3N2O5/c21-11-1-3-14(23)10(5-11)8-25-16(26)7-20(19(25)30)13-6-12(22)2-4-15(13)24(18(20)29)9-17(27)28/h1-6H,7-9H2,(H,27,28) |
| InChIKey | VITIJZLHMBHKEV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|