C12H8ClN3O5 — CID 67497807
2-(5'-chloro-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetic acid (PubChem CID 67497807) has the molecular formula C12H8ClN3O5 and a molecular weight of 309.67 g/mol. Its IUPAC name is 2-(5'-chloro-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetic acid.
| Compound Name | 2-(5'-chloro-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetic acid |
|---|---|
| PubChem CID | 67497807 |
| Molecular Formula | C12H8ClN3O5 |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-(5'-chloro-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)C2(NC(=O)NC2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H8ClN3O5/c13-5-1-2-7-6(3-5)12(9(19)14-11(21)15-12)10(20)16(7)4-8(17)18/h1-3H,4H2,(H,17,18)(H2,14,15,19,21) |
| InChIKey | BCLPILJCUWPSEL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|