C12H10N4O4 — CID 143523228
2-(2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetamide (PubChem CID 143523228) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2-(2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetamide.
| Compound Name | 2-(2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetamide |
|---|---|
| PubChem CID | 143523228 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-(2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl)acetamide |
| SMILES | NC(=O)CN1C(=O)C2(NC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C12H10N4O4/c13-8(17)5-16-7-4-2-1-3-6(7)12(10(16)19)9(18)14-11(20)15-12/h1-4H,5H2,(H2,13,17)(H2,14,15,18,20) |
| InChIKey | OJZVUTLKHCHLPZ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|