C14H13N3O3 — CID 24820788
1'-(cyclopropylmethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24820788) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 1'-(cyclopropylmethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1'-(cyclopropylmethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24820788 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1'-(cyclopropylmethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | O=C1NC(=O)C2(N1)C(=O)N(CC1CC1)c1ccccc12 |
| InChI | InChI=1S/C14H13N3O3/c18-11-14(16-13(20)15-11)9-3-1-2-4-10(9)17(12(14)19)7-8-5-6-8/h1-4,8H,5-7H2,(H2,15,16,18,20) |
| InChIKey | WEZZYWMZHLAXNW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|