C17H22N2O2 — CID 79906794
1-(cyclopropylmethyl)-3,3-diethyl-4H-1,4-benzodiazepine-2,5-dione (PubChem CID 79906794) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3,3-diethyl-4H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 1-(cyclopropylmethyl)-3,3-diethyl-4H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 79906794 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-(cyclopropylmethyl)-3,3-diethyl-4H-1,4-benzodiazepine-2,5-dione |
| SMILES | CCC1(CC)NC(=O)c2ccccc2N(CC2CC2)C1=O |
| InChI | InChI=1S/C17H22N2O2/c1-3-17(4-2)16(21)19(11-12-9-10-12)14-8-6-5-7-13(14)15(20)18-17/h5-8,12H,3-4,9-11H2,1-2H3,(H,18,20) |
| InChIKey | LFZKXSZRODVEQY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |