C15H18N2O3 — CID 79909619
1-(oxan-4-ylmethyl)-3,4-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 79909619) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(oxan-4-ylmethyl)-3,4-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | 1-(oxan-4-ylmethyl)-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 79909619 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-(oxan-4-ylmethyl)-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1NCC(=O)N(CC2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C15H18N2O3/c18-14-9-16-15(19)12-3-1-2-4-13(12)17(14)10-11-5-7-20-8-6-11/h1-4,11H,5-10H2,(H,16,19) |
| InChIKey | HNVRXOKXSONWQU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |