C22H23N3O3 — CID 24750578
1'-[(4-tert-butylphenyl)methyl]-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24750578) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1'-[(4-tert-butylphenyl)methyl]-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1'-[(4-tert-butylphenyl)methyl]-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24750578 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1'-[(4-tert-butylphenyl)methyl]-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | Cc1ccc2c(c1)C1(NC(=O)NC1=O)C(=O)N2Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-13-5-10-17-16(11-13)22(18(26)23-20(28)24-22)19(27)25(17)12-14-6-8-15(9-7-14)21(2,3)4/h5-11H,12H2,1-4H3,(H2,23,24,26,28) |
| InChIKey | FGUOEIMVSHLYFH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|