C14H12ClN3O5 — CID 160820013
2-[(4R)-5'-chloro-1-ethyl-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid (PubChem CID 160820013) has the molecular formula C14H12ClN3O5 and a molecular weight of 337.72 g/mol. Its IUPAC name is 2-[(4R)-5'-chloro-1-ethyl-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid.
| Compound Name | 2-[(4R)-5'-chloro-1-ethyl-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid |
|---|---|
| PubChem CID | 160820013 |
| Molecular Formula | C14H12ClN3O5 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-[(4R)-5'-chloro-1-ethyl-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid |
| SMILES | CCN1C(=O)N[C@@]2(C1=O)C(=O)N(CC(=O)O)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C14H12ClN3O5/c1-2-17-11(21)14(16-13(17)23)8-5-7(15)3-4-9(8)18(12(14)22)6-10(19)20/h3-5H,2,6H2,1H3,(H,16,23)(H,19,20)/t14-/m0/s1 |
| InChIKey | VPXYNEAKKJLNNQ-AWEZNQCLSA-N |
| XLogP | 0.54 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|