C21H17Cl2N3O5 — CID 50902747
2-[(4R)-5'-chloro-1-[2-(3-chlorophenyl)ethyl]-3-methyl-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid (PubChem CID 50902747) has the molecular formula C21H17Cl2N3O5 and a molecular weight of 462.29 g/mol. Its IUPAC name is 2-[(4R)-5'-chloro-1-[2-(3-chlorophenyl)ethyl]-3-methyl-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid.
| Compound Name | 2-[(4R)-5'-chloro-1-[2-(3-chlorophenyl)ethyl]-3-methyl-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid |
|---|---|
| PubChem CID | 50902747 |
| Molecular Formula | C21H17Cl2N3O5 |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 2-[(4R)-5'-chloro-1-[2-(3-chlorophenyl)ethyl]-3-methyl-2,2',5-trioxospiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid |
| SMILES | CN1C(=O)N(CCc2cccc(Cl)c2)C(=O)[C@@]12C(=O)N(CC(=O)O)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C21H17Cl2N3O5/c1-24-20(31)25(8-7-12-3-2-4-13(22)9-12)18(29)21(24)15-10-14(23)5-6-16(15)26(19(21)30)11-17(27)28/h2-6,9-10H,7-8,11H2,1H3,(H,27,28)/t21-/m0/s1 |
| InChIKey | GUVDBRIEDBFKHJ-NRFANRHFSA-N |
| XLogP | 2.76 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|