C25H21ClN2O2 — CID 2945553
5-chloro-3-hydroxy-3-(2-methyl-1H-indol-3-yl)-1-(2-phenylethyl)indol-2-one (PubChem CID 2945553) has the molecular formula C25H21ClN2O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 5-chloro-3-hydroxy-3-(2-methyl-1H-indol-3-yl)-1-(2-phenylethyl)indol-2-one.
| Compound Name | 5-chloro-3-hydroxy-3-(2-methyl-1H-indol-3-yl)-1-(2-phenylethyl)indol-2-one |
|---|---|
| PubChem CID | 2945553 |
| Molecular Formula | C25H21ClN2O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 5-chloro-3-hydroxy-3-(2-methyl-1H-indol-3-yl)-1-(2-phenylethyl)indol-2-one |
| SMILES | Cc1[nH]c2ccccc2c1C1(O)C(=O)N(CCc2ccccc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H21ClN2O2/c1-16-23(19-9-5-6-10-21(19)27-16)25(30)20-15-18(26)11-12-22(20)28(24(25)29)14-13-17-7-3-2-4-8-17/h2-12,15,27,30H,13-14H2,1H3 |
| InChIKey | UUJWLKXNSONUEO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |