C24H19ClN2O2 — CID 7275526
(3S)-5-chloro-3-hydroxy-3-(1H-indol-3-yl)-1-[(2-methylphenyl)methyl]indol-2-one (PubChem CID 7275526) has the molecular formula C24H19ClN2O2 and a molecular weight of 402.88 g/mol. Its IUPAC name is (3S)-5-chloro-3-hydroxy-3-(1H-indol-3-yl)-1-[(2-methylphenyl)methyl]indol-2-one.
| Compound Name | (3S)-5-chloro-3-hydroxy-3-(1H-indol-3-yl)-1-[(2-methylphenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 7275526 |
| Molecular Formula | C24H19ClN2O2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (3S)-5-chloro-3-hydroxy-3-(1H-indol-3-yl)-1-[(2-methylphenyl)methyl]indol-2-one |
| SMILES | Cc1ccccc1CN1C(=O)[C@](O)(c2c[nH]c3ccccc23)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H19ClN2O2/c1-15-6-2-3-7-16(15)14-27-22-11-10-17(25)12-19(22)24(29,23(27)28)20-13-26-21-9-5-4-8-18(20)21/h2-13,26,29H,14H2,1H3/t24-/m1/s1 |
| InChIKey | UCRDJPSXMXMKCG-XMMPIXPASA-N |
| XLogP | 4.91 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |