C23H16BrClN2O2 — CID 118710088
1-benzyl-3-(5-bromo-1H-indol-3-yl)-5-chloro-3-hydroxyindol-2-one (PubChem CID 118710088) has the molecular formula C23H16BrClN2O2 and a molecular weight of 467.75 g/mol. Its IUPAC name is 1-benzyl-3-(5-bromo-1H-indol-3-yl)-5-chloro-3-hydroxyindol-2-one.
| Compound Name | 1-benzyl-3-(5-bromo-1H-indol-3-yl)-5-chloro-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 118710088 |
| Molecular Formula | C23H16BrClN2O2 |
| Molecular Weight | 467.75 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 1-benzyl-3-(5-bromo-1H-indol-3-yl)-5-chloro-3-hydroxyindol-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccc(Cl)cc2C1(O)c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C23H16BrClN2O2/c24-15-6-8-20-17(10-15)19(12-26-20)23(29)18-11-16(25)7-9-21(18)27(22(23)28)13-14-4-2-1-3-5-14/h1-12,26,29H,13H2 |
| InChIKey | OBBYNVRPHFZROG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |