C22H18Cl2FN3O5 — CID 50902823
2-[(4R)-5'-chloro-1-[(5-chloro-2-fluorophenyl)methyl]-2,2',5-trioxo-3-propylspiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid (PubChem CID 50902823) has the molecular formula C22H18Cl2FN3O5 and a molecular weight of 494.31 g/mol. Its IUPAC name is 2-[(4R)-5'-chloro-1-[(5-chloro-2-fluorophenyl)methyl]-2,2',5-trioxo-3-propylspiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid.
| Compound Name | 2-[(4R)-5'-chloro-1-[(5-chloro-2-fluorophenyl)methyl]-2,2',5-trioxo-3-propylspiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid |
|---|---|
| PubChem CID | 50902823 |
| Molecular Formula | C22H18Cl2FN3O5 |
| Molecular Weight | 494.31 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-[(4R)-5'-chloro-1-[(5-chloro-2-fluorophenyl)methyl]-2,2',5-trioxo-3-propylspiro[imidazolidine-4,3'-indole]-1'-yl]acetic acid |
| SMILES | CCCN1C(=O)N(Cc2cc(Cl)ccc2F)C(=O)[C@@]12C(=O)N(CC(=O)O)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C22H18Cl2FN3O5/c1-2-7-28-21(33)27(10-12-8-13(23)3-5-16(12)25)20(32)22(28)15-9-14(24)4-6-17(15)26(19(22)31)11-18(29)30/h3-6,8-9H,2,7,10-11H2,1H3,(H,29,30)/t22-/m1/s1 |
| InChIKey | SSOKTSVCXCLLOM-JOCHJYFZSA-N |
| XLogP | 3.63 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|