C21H18ClF2N3O5 — CID 88982631
2-[(3S)-5-chloro-3-[[(2,5-difluorophenyl)methyl-methylcarbamoyl]-methylamino]-3-formyl-2-oxoindol-1-yl]acetic acid (PubChem CID 88982631) has the molecular formula C21H18ClF2N3O5 and a molecular weight of 465.84 g/mol. Its IUPAC name is 2-[(3S)-5-chloro-3-[[(2,5-difluorophenyl)methyl-methylcarbamoyl]-methylamino]-3-formyl-2-oxoindol-1-yl]acetic acid.
| Compound Name | 2-[(3S)-5-chloro-3-[[(2,5-difluorophenyl)methyl-methylcarbamoyl]-methylamino]-3-formyl-2-oxoindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 88982631 |
| Molecular Formula | C21H18ClF2N3O5 |
| Molecular Weight | 465.84 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 2-[(3S)-5-chloro-3-[[(2,5-difluorophenyl)methyl-methylcarbamoyl]-methylamino]-3-formyl-2-oxoindol-1-yl]acetic acid |
| SMILES | CN(Cc1cc(F)ccc1F)C(=O)N(C)[C@@]1(C=O)C(=O)N(CC(=O)O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H18ClF2N3O5/c1-25(9-12-7-14(23)4-5-16(12)24)20(32)26(2)21(11-28)15-8-13(22)3-6-17(15)27(19(21)31)10-18(29)30/h3-8,11H,9-10H2,1-2H3,(H,29,30)/t21-/m1/s1 |
| InChIKey | PZRJXDWIVVINKW-OAQYLSRUSA-N |
| XLogP | 2.63 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|