C24H25N3O7 — CID 127048917
tert-butyl N-[2-[[(1-hydroxy-3,4-dioxonaphthalen-2-yl)-(4-nitrophenyl)methyl]amino]ethyl]carbamate (PubChem CID 127048917) has the molecular formula C24H25N3O7 and a molecular weight of 467.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[(1-hydroxy-3,4-dioxonaphthalen-2-yl)-(4-nitrophenyl)methyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(1-hydroxy-3,4-dioxonaphthalen-2-yl)-(4-nitrophenyl)methyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 127048917 |
| Molecular Formula | C24H25N3O7 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | tert-butyl N-[2-[[(1-hydroxy-3,4-dioxonaphthalen-2-yl)-(4-nitrophenyl)methyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(C1=C(O)c2ccccc2C(=O)C1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H25N3O7/c1-24(2,3)34-23(31)26-13-12-25-19(14-8-10-15(11-9-14)27(32)33)18-20(28)16-6-4-5-7-17(16)21(29)22(18)30/h4-11,19,25,28H,12-13H2,1-3H3,(H,26,31) |
| InChIKey | IDOJBHZSDYDGQU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|