C20H20FNO3 — CID 166807948
tert-butyl (3R)-5-fluoro-3-(2-methylphenyl)-2-oxo-3H-indole-1-carboxylate (PubChem CID 166807948) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is tert-butyl (3R)-5-fluoro-3-(2-methylphenyl)-2-oxo-3H-indole-1-carboxylate.
| Compound Name | tert-butyl (3R)-5-fluoro-3-(2-methylphenyl)-2-oxo-3H-indole-1-carboxylate |
|---|---|
| PubChem CID | 166807948 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl (3R)-5-fluoro-3-(2-methylphenyl)-2-oxo-3H-indole-1-carboxylate |
| SMILES | Cc1ccccc1[C@H]1C(=O)N(C(=O)OC(C)(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C20H20FNO3/c1-12-7-5-6-8-14(12)17-15-11-13(21)9-10-16(15)22(18(17)23)19(24)25-20(2,3)4/h5-11,17H,1-4H3/t17-/m1/s1 |
| InChIKey | ZLGANCIMYTURDI-QGZVFWFLSA-N |
| XLogP | 4.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |