C24H32FNO4 — CID 118321688
tert-butyl 3-(4-butylcyclohexanecarbonyl)-5-fluoro-2-oxo-3H-indole-1-carboxylate (PubChem CID 118321688) has the molecular formula C24H32FNO4 and a molecular weight of 417.52 g/mol. Its IUPAC name is tert-butyl 3-(4-butylcyclohexanecarbonyl)-5-fluoro-2-oxo-3H-indole-1-carboxylate.
| Compound Name | tert-butyl 3-(4-butylcyclohexanecarbonyl)-5-fluoro-2-oxo-3H-indole-1-carboxylate |
|---|---|
| PubChem CID | 118321688 |
| Molecular Formula | C24H32FNO4 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | tert-butyl 3-(4-butylcyclohexanecarbonyl)-5-fluoro-2-oxo-3H-indole-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)C2C(=O)N(C(=O)OC(C)(C)C)c3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C24H32FNO4/c1-5-6-7-15-8-10-16(11-9-15)21(27)20-18-14-17(25)12-13-19(18)26(22(20)28)23(29)30-24(2,3)4/h12-16,20H,5-11H2,1-4H3 |
| InChIKey | ZWRQLEALCHAIKI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|