C19H21F3OS — CID 51113119
1-[(4-tert-butylphenyl)methylsulfinylmethyl]-3-(trifluoromethyl)benzene (PubChem CID 51113119) has the molecular formula C19H21F3OS and a molecular weight of 354.44 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methylsulfinylmethyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[(4-tert-butylphenyl)methylsulfinylmethyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 51113119 |
| Molecular Formula | C19H21F3OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methylsulfinylmethyl]-3-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)c1ccc(CS(=O)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H21F3OS/c1-18(2,3)16-9-7-14(8-10-16)12-24(23)13-15-5-4-6-17(11-15)19(20,21)22/h4-11H,12-13H2,1-3H3 |
| InChIKey | BCSBKLAMVRVWNF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |