C10H12F3NOS — CID 58684611
2-[[3-(trifluoromethyl)phenyl]methylsulfinyl]ethanamine (PubChem CID 58684611) has the molecular formula C10H12F3NOS and a molecular weight of 251.27 g/mol. Its IUPAC name is 2-[[3-(trifluoromethyl)phenyl]methylsulfinyl]ethanamine.
| Compound Name | 2-[[3-(trifluoromethyl)phenyl]methylsulfinyl]ethanamine |
|---|---|
| PubChem CID | 58684611 |
| Molecular Formula | C10H12F3NOS |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-[[3-(trifluoromethyl)phenyl]methylsulfinyl]ethanamine |
| SMILES | NCCS(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3NOS/c11-10(12,13)9-3-1-2-8(6-9)7-16(15)5-4-14/h1-3,6H,4-5,7,14H2 |
| InChIKey | CVHUCWAVJCSFEE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |