C11H17NOS — CID 81175012
2-[(3,4-dimethylphenyl)methylsulfinyl]ethanamine (PubChem CID 81175012) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)methylsulfinyl]ethanamine.
| Compound Name | 2-[(3,4-dimethylphenyl)methylsulfinyl]ethanamine |
|---|---|
| PubChem CID | 81175012 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)methylsulfinyl]ethanamine |
| SMILES | Cc1ccc(CS(=O)CCN)cc1C |
| InChI | InChI=1S/C11H17NOS/c1-9-3-4-11(7-10(9)2)8-14(13)6-5-12/h3-4,7H,5-6,8,12H2,1-2H3 |
| InChIKey | PWCDHHBWHLVALX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |