C12H19NOS — CID 97070832
N-[(3,4-dimethylphenyl)methyl]-2-[(S)-methylsulfinyl]ethanamine (PubChem CID 97070832) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]-2-[(S)-methylsulfinyl]ethanamine.
| Compound Name | N-[(3,4-dimethylphenyl)methyl]-2-[(S)-methylsulfinyl]ethanamine |
|---|---|
| PubChem CID | 97070832 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]-2-[(S)-methylsulfinyl]ethanamine |
| SMILES | Cc1ccc(CNCC[S@](C)=O)cc1C |
| InChI | InChI=1S/C12H19NOS/c1-10-4-5-12(8-11(10)2)9-13-6-7-15(3)14/h4-5,8,13H,6-7,9H2,1-3H3/t15-/m0/s1 |
| InChIKey | JHUFPWFMBMMXTJ-HNNXBMFYSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|