C10H12F3NOS — CID 115632551
2-methylsulfinyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine (PubChem CID 115632551) has the molecular formula C10H12F3NOS and a molecular weight of 251.27 g/mol. Its IUPAC name is 2-methylsulfinyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine.
| Compound Name | 2-methylsulfinyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 115632551 |
| Molecular Formula | C10H12F3NOS |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-methylsulfinyl-N-[(3,4,5-trifluorophenyl)methyl]ethanamine |
| SMILES | CS(=O)CCNCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H12F3NOS/c1-16(15)3-2-14-6-7-4-8(11)10(13)9(12)5-7/h4-5,14H,2-3,6H2,1H3 |
| InChIKey | ZAXZWHRCJZHHEF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|