C9H13FN2OS — CID 104953724
N-[(5-fluoro-3-pyridinyl)methyl]-2-methylsulfinylethanamine (PubChem CID 104953724) has the molecular formula C9H13FN2OS and a molecular weight of 216.28 g/mol. Its IUPAC name is N-[(5-fluoro-3-pyridinyl)methyl]-2-methylsulfinylethanamine.
| Compound Name | N-[(5-fluoro-3-pyridinyl)methyl]-2-methylsulfinylethanamine |
|---|---|
| PubChem CID | 104953724 |
| Molecular Formula | C9H13FN2OS |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-[(5-fluoro-3-pyridinyl)methyl]-2-methylsulfinylethanamine |
| SMILES | CS(=O)CCNCc1cncc(F)c1 |
| InChI | InChI=1S/C9H13FN2OS/c1-14(13)3-2-11-5-8-4-9(10)7-12-6-8/h4,6-7,11H,2-3,5H2,1H3 |
| InChIKey | JTESZVLUKFTFQD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|