C12H17FN2O — CID 104953835
N-[(5-fluoro-3-pyridinyl)methyl]-2-(2-methylprop-2-enoxy)ethanamine (PubChem CID 104953835) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is N-[(5-fluoro-3-pyridinyl)methyl]-2-(2-methylprop-2-enoxy)ethanamine.
| Compound Name | N-[(5-fluoro-3-pyridinyl)methyl]-2-(2-methylprop-2-enoxy)ethanamine |
|---|---|
| PubChem CID | 104953835 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-[(5-fluoro-3-pyridinyl)methyl]-2-(2-methylprop-2-enoxy)ethanamine |
| SMILES | C=C(C)COCCNCc1cncc(F)c1 |
| InChI | InChI=1S/C12H17FN2O/c1-10(2)9-16-4-3-14-6-11-5-12(13)8-15-7-11/h5,7-8,14H,1,3-4,6,9H2,2H3 |
| InChIKey | HUASXDOAZYUOGG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|