C10H13F2NOS — CID 115632625
N-[(2,3-difluorophenyl)methyl]-2-methylsulfinylethanamine (PubChem CID 115632625) has the molecular formula C10H13F2NOS and a molecular weight of 233.28 g/mol. Its IUPAC name is N-[(2,3-difluorophenyl)methyl]-2-methylsulfinylethanamine.
| Compound Name | N-[(2,3-difluorophenyl)methyl]-2-methylsulfinylethanamine |
|---|---|
| PubChem CID | 115632625 |
| Molecular Formula | C10H13F2NOS |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-[(2,3-difluorophenyl)methyl]-2-methylsulfinylethanamine |
| SMILES | CS(=O)CCNCc1cccc(F)c1F |
| InChI | InChI=1S/C10H13F2NOS/c1-15(14)6-5-13-7-8-3-2-4-9(11)10(8)12/h2-4,13H,5-7H2,1H3 |
| InChIKey | OEOXEACSBGIZNF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|