C12H15F2N — CID 115629131
(E)-N-[(2,3-difluorophenyl)methyl]pent-3-en-1-amine (PubChem CID 115629131) has the molecular formula C12H15F2N and a molecular weight of 211.26 g/mol. Its IUPAC name is (E)-N-[(2,3-difluorophenyl)methyl]pent-3-en-1-amine.
| Compound Name | (E)-N-[(2,3-difluorophenyl)methyl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 115629131 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (E)-N-[(2,3-difluorophenyl)methyl]pent-3-en-1-amine |
| SMILES | C/C=C/CCNCc1cccc(F)c1F |
| InChI | InChI=1S/C12H15F2N/c1-2-3-4-8-15-9-10-6-5-7-11(13)12(10)14/h2-3,5-7,15H,4,8-9H2,1H3/b3-2+ |
| InChIKey | WEAQSCDZKZYVIH-NSCUHMNNSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|