C15H18FNO2S — CID 100614726
N-[[5-(3-fluoro-2-methylphenyl)furan-2-yl]methyl]-2-[(R)-methylsulfinyl]ethanamine (PubChem CID 100614726) has the molecular formula C15H18FNO2S and a molecular weight of 295.38 g/mol. Its IUPAC name is N-[[5-(3-fluoro-2-methylphenyl)furan-2-yl]methyl]-2-[(R)-methylsulfinyl]ethanamine.
| Compound Name | N-[[5-(3-fluoro-2-methylphenyl)furan-2-yl]methyl]-2-[(R)-methylsulfinyl]ethanamine |
|---|---|
| PubChem CID | 100614726 |
| Molecular Formula | C15H18FNO2S |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[[5-(3-fluoro-2-methylphenyl)furan-2-yl]methyl]-2-[(R)-methylsulfinyl]ethanamine |
| SMILES | Cc1c(F)cccc1-c1ccc(CNCC[S@@](C)=O)o1 |
| InChI | InChI=1S/C15H18FNO2S/c1-11-13(4-3-5-14(11)16)15-7-6-12(19-15)10-17-8-9-20(2)18/h3-7,17H,8-10H2,1-2H3/t20-/m1/s1 |
| InChIKey | AUDJRKHNIMEGNV-HXUWFJFHSA-N |
| XLogP | 2.86 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|