C16H23Cl2FN2O2 — CID 17214280
2-[3-[[5-(2-fluorophenyl)furan-2-yl]methylamino]propylamino]ethanol;dihydrochloride (PubChem CID 17214280) has the molecular formula C16H23Cl2FN2O2 and a molecular weight of 365.28 g/mol. Its IUPAC name is 2-[3-[[5-(2-fluorophenyl)furan-2-yl]methylamino]propylamino]ethanol;dihydrochloride.
| Compound Name | 2-[3-[[5-(2-fluorophenyl)furan-2-yl]methylamino]propylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17214280 |
| Molecular Formula | C16H23Cl2FN2O2 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[3-[[5-(2-fluorophenyl)furan-2-yl]methylamino]propylamino]ethanol;dihydrochloride |
| SMILES | Cl.Cl.OCCNCCCNCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C16H21FN2O2.2ClH/c17-15-5-2-1-4-14(15)16-7-6-13(21-16)12-19-9-3-8-18-10-11-20;;/h1-2,4-7,18-20H,3,8-12H2;2*1H |
| InChIKey | GSIIEDULLUSFNE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|