C15H20Cl4N2O2 — CID 17332050
2-[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]ethylamino]ethanol;dihydrochloride (PubChem CID 17332050) has the molecular formula C15H20Cl4N2O2 and a molecular weight of 402.15 g/mol. Its IUPAC name is 2-[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]ethylamino]ethanol;dihydrochloride.
| Compound Name | 2-[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]ethylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17332050 |
| Molecular Formula | C15H20Cl4N2O2 |
| Molecular Weight | 402.15 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]ethylamino]ethanol;dihydrochloride |
| SMILES | Cl.Cl.OCCNCCNCc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C15H18Cl2N2O2.2ClH/c16-11-1-3-14(17)13(9-11)15-4-2-12(21-15)10-19-6-5-18-7-8-20;;/h1-4,9,18-20H,5-8,10H2;2*1H |
| InChIKey | VGKGLKYTRITTFQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.15 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|