C14H17NOS — CID 115632533
2-methylsulfinyl-N-(naphthalen-2-ylmethyl)ethanamine (PubChem CID 115632533) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-methylsulfinyl-N-(naphthalen-2-ylmethyl)ethanamine.
| Compound Name | 2-methylsulfinyl-N-(naphthalen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115632533 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-methylsulfinyl-N-(naphthalen-2-ylmethyl)ethanamine |
| SMILES | CS(=O)CCNCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H17NOS/c1-17(16)9-8-15-11-12-6-7-13-4-2-3-5-14(13)10-12/h2-7,10,15H,8-9,11H2,1H3 |
| InChIKey | YPMZBJGQJOQQOU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|