C19H15F4NO4S — CID 18385995
4-[5,5-dimethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]-2-fluorobenzenesulfonamide (PubChem CID 18385995) has the molecular formula C19H15F4NO4S and a molecular weight of 429.39 g/mol. Its IUPAC name is 4-[5,5-dimethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-[5,5-dimethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 18385995 |
| Molecular Formula | C19H15F4NO4S |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 4-[5,5-dimethyl-4-oxo-3-[3-(trifluoromethyl)phenyl]furan-2-yl]-2-fluorobenzenesulfonamide |
| SMILES | CC1(C)OC(c2ccc(S(N)(=O)=O)c(F)c2)=C(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C19H15F4NO4S/c1-18(2)17(25)15(10-4-3-5-12(8-10)19(21,22)23)16(28-18)11-6-7-14(13(20)9-11)29(24,26)27/h3-9H,1-2H3,(H2,24,26,27) |
| InChIKey | CWKRSLZCNISUHR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|