C20H16F4O3S — CID 18386027
4-[3-fluoro-5-(trifluoromethyl)phenyl]-2,2-dimethyl-5-(4-methylsulfinylphenyl)furan-3-one (PubChem CID 18386027) has the molecular formula C20H16F4O3S and a molecular weight of 412.40 g/mol. Its IUPAC name is 4-[3-fluoro-5-(trifluoromethyl)phenyl]-2,2-dimethyl-5-(4-methylsulfinylphenyl)furan-3-one.
| Compound Name | 4-[3-fluoro-5-(trifluoromethyl)phenyl]-2,2-dimethyl-5-(4-methylsulfinylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18386027 |
| Molecular Formula | C20H16F4O3S |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 4-[3-fluoro-5-(trifluoromethyl)phenyl]-2,2-dimethyl-5-(4-methylsulfinylphenyl)furan-3-one |
| SMILES | CS(=O)c1ccc(C2=C(c3cc(F)cc(C(F)(F)F)c3)C(=O)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H16F4O3S/c1-19(2)18(25)16(12-8-13(20(22,23)24)10-14(21)9-12)17(27-19)11-4-6-15(7-5-11)28(3)26/h4-10H,1-3H3 |
| InChIKey | DXTRYYVSKFYGTL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|