C19H16F2O2S — CID 18386099
4-(2,5-difluorophenyl)-2,2-dimethyl-5-(4-methylsulfanylphenyl)furan-3-one (PubChem CID 18386099) has the molecular formula C19H16F2O2S and a molecular weight of 346.40 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-2,2-dimethyl-5-(4-methylsulfanylphenyl)furan-3-one.
| Compound Name | 4-(2,5-difluorophenyl)-2,2-dimethyl-5-(4-methylsulfanylphenyl)furan-3-one |
|---|---|
| PubChem CID | 18386099 |
| Molecular Formula | C19H16F2O2S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-(2,5-difluorophenyl)-2,2-dimethyl-5-(4-methylsulfanylphenyl)furan-3-one |
| SMILES | CSc1ccc(C2=C(c3cc(F)ccc3F)C(=O)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H16F2O2S/c1-19(2)18(22)16(14-10-12(20)6-9-15(14)21)17(23-19)11-4-7-13(24-3)8-5-11/h4-10H,1-3H3 |
| InChIKey | XBBUCKMLZSWGNZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|