C18H13F3O2S — CID 70908651
4-(3,5-difluorophenyl)-5-(2-fluoro-4-sulfanylphenyl)-2,2-dimethylfuran-3-one (PubChem CID 70908651) has the molecular formula C18H13F3O2S and a molecular weight of 350.36 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-5-(2-fluoro-4-sulfanylphenyl)-2,2-dimethylfuran-3-one.
| Compound Name | 4-(3,5-difluorophenyl)-5-(2-fluoro-4-sulfanylphenyl)-2,2-dimethylfuran-3-one |
|---|---|
| PubChem CID | 70908651 |
| Molecular Formula | C18H13F3O2S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 4-(3,5-difluorophenyl)-5-(2-fluoro-4-sulfanylphenyl)-2,2-dimethylfuran-3-one |
| SMILES | CC1(C)OC(c2ccc(S)cc2F)=C(c2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C18H13F3O2S/c1-18(2)17(22)15(9-5-10(19)7-11(20)6-9)16(23-18)13-4-3-12(24)8-14(13)21/h3-8,24H,1-2H3 |
| InChIKey | IWDHMVYBMIIXGZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|