C20H18FO3S+ — CID 174434196
[4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-methylphenyl]methyl-oxosulfanium (PubChem CID 174434196) has the molecular formula C20H18FO3S+ and a molecular weight of 357.43 g/mol. Its IUPAC name is [4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-methylphenyl]methyl-oxosulfanium.
| Compound Name | [4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-methylphenyl]methyl-oxosulfanium |
|---|---|
| PubChem CID | 174434196 |
| Molecular Formula | C20H18FO3S+ |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-methylphenyl]methyl-oxosulfanium |
| SMILES | Cc1cc(C2=C(c3cccc(F)c3)C(=O)C(C)(C)O2)ccc1C[S+]=O |
| InChI | InChI=1S/C20H18FO3S/c1-12-9-14(7-8-15(12)11-25-23)18-17(19(22)20(2,3)24-18)13-5-4-6-16(21)10-13/h4-10H,11H2,1-3H3/q+1 |
| InChIKey | XOCPZCGVPASVJV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|