C18H14FO4S- — CID 144852186
4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfinate (PubChem CID 144852186) has the molecular formula C18H14FO4S- and a molecular weight of 345.37 g/mol. Its IUPAC name is 4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfinate.
| Compound Name | 4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfinate |
|---|---|
| PubChem CID | 144852186 |
| Molecular Formula | C18H14FO4S- |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 4-[3-(3-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfinate |
| SMILES | CC1(C)OC(c2ccc(S(=O)[O-])cc2)=C(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C18H15FO4S/c1-18(2)17(20)15(12-4-3-5-13(19)10-12)16(23-18)11-6-8-14(9-7-11)24(21)22/h3-10H,1-2H3,(H,21,22)/p-1 |
| InChIKey | HAVVNDYIJNDPOR-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|