C19H18FNO4S — CID 59243643
5-(4-aminoperoxysulfanyl-3-methylphenyl)-4-(3-fluorophenyl)-2,2-dimethylfuran-3-one (PubChem CID 59243643) has the molecular formula C19H18FNO4S and a molecular weight of 375.42 g/mol. Its IUPAC name is 5-(4-aminoperoxysulfanyl-3-methylphenyl)-4-(3-fluorophenyl)-2,2-dimethylfuran-3-one.
| Compound Name | 5-(4-aminoperoxysulfanyl-3-methylphenyl)-4-(3-fluorophenyl)-2,2-dimethylfuran-3-one |
|---|---|
| PubChem CID | 59243643 |
| Molecular Formula | C19H18FNO4S |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 5-(4-aminoperoxysulfanyl-3-methylphenyl)-4-(3-fluorophenyl)-2,2-dimethylfuran-3-one |
| SMILES | Cc1cc(C2=C(c3cccc(F)c3)C(=O)C(C)(C)O2)ccc1SOON |
| InChI | InChI=1S/C19H18FNO4S/c1-11-9-13(7-8-15(11)26-25-24-21)17-16(18(22)19(2,3)23-17)12-5-4-6-14(20)10-12/h4-10H,21H2,1-3H3 |
| InChIKey | KEPUUTLJRLSICE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|