C18H14F3NO4S — CID 59243646
5-(4-aminoperoxysulfanyl-2-fluorophenyl)-4-(3,5-difluorophenyl)-2,2-dimethylfuran-3-one (PubChem CID 59243646) has the molecular formula C18H14F3NO4S and a molecular weight of 397.37 g/mol. Its IUPAC name is 5-(4-aminoperoxysulfanyl-2-fluorophenyl)-4-(3,5-difluorophenyl)-2,2-dimethylfuran-3-one.
| Compound Name | 5-(4-aminoperoxysulfanyl-2-fluorophenyl)-4-(3,5-difluorophenyl)-2,2-dimethylfuran-3-one |
|---|---|
| PubChem CID | 59243646 |
| Molecular Formula | C18H14F3NO4S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 5-(4-aminoperoxysulfanyl-2-fluorophenyl)-4-(3,5-difluorophenyl)-2,2-dimethylfuran-3-one |
| SMILES | CC1(C)OC(c2ccc(SOON)cc2F)=C(c2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C18H14F3NO4S/c1-18(2)17(23)15(9-5-10(19)7-11(20)6-9)16(24-18)13-4-3-12(8-14(13)21)27-26-25-22/h3-8H,22H2,1-2H3 |
| InChIKey | JAHVVWOWVLFELD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|