C12H13Cl2NO4S — CID 89098677
[4-[(4R,5R)-2-(dichloromethyl)-4-(hydroxymethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid (PubChem CID 89098677) has the molecular formula C12H13Cl2NO4S and a molecular weight of 338.21 g/mol. Its IUPAC name is [4-[(4R,5R)-2-(dichloromethyl)-4-(hydroxymethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[(4R,5R)-2-(dichloromethyl)-4-(hydroxymethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 89098677 |
| Molecular Formula | C12H13Cl2NO4S |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | [4-[(4R,5R)-2-(dichloromethyl)-4-(hydroxymethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc([C@H]2OC(C(Cl)Cl)=N[C@@H]2CO)cc1 |
| InChI | InChI=1S/C12H13Cl2NO4S/c13-11(14)12-15-9(5-16)10(19-12)8-3-1-7(2-4-8)6-20(17)18/h1-4,9-11,16H,5-6H2,(H,17,18)/t9-,10-/m1/s1 |
| InChIKey | HBLCOQLGWJJIGV-NXEZZACHSA-N |
| XLogP | 2.04 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|