C17H15NO3S — CID 167387476
[4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]methanesulfinic acid (PubChem CID 167387476) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is [4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]methanesulfinic acid.
| Compound Name | [4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 167387476 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | [4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]methanesulfinic acid |
| SMILES | Cc1onc(-c2ccccc2)c1-c1ccc(CS(=O)O)cc1 |
| InChI | InChI=1S/C17H15NO3S/c1-12-16(14-9-7-13(8-10-14)11-22(19)20)17(18-21-12)15-5-3-2-4-6-15/h2-10H,11H2,1H3,(H,19,20) |
| InChIKey | HFJQMBFWOLOBDO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|