C21H20F6N2O3S — CID 18993449
1-ethyl-4-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazole;methanol (PubChem CID 18993449) has the molecular formula C21H20F6N2O3S and a molecular weight of 494.46 g/mol. Its IUPAC name is 1-ethyl-4-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazole;methanol.
| Compound Name | 1-ethyl-4-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazole;methanol |
|---|---|
| PubChem CID | 18993449 |
| Molecular Formula | C21H20F6N2O3S |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 1-ethyl-4-(3-fluorophenyl)-3-(4-methylsulfonylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazole;methanol |
| SMILES | CCn1nc(-c2ccc(S(C)(=O)=O)cc2)c(-c2cccc(F)c2)c1C(F)(F)C(F)(F)F.CO |
| InChI | InChI=1S/C20H16F6N2O2S.CH4O/c1-3-28-18(19(22,23)20(24,25)26)16(13-5-4-6-14(21)11-13)17(27-28)12-7-9-15(10-8-12)31(2,29)30;1-2/h4-11H,3H2,1-2H3;2H,1H3 |
| InChIKey | UQSTYVHZRPVVPW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|